
CAS 911312-77-1
:Benzoic acid, 3-chloro-4-(1H-pyrazol-1-yl)-
Description:
Benzoic acid, 3-chloro-4-(1H-pyrazol-1-yl)-, identified by its CAS number 911312-77-1, is an organic compound characterized by the presence of a benzoic acid moiety substituted with a chloro group and a pyrazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including a relatively high melting point and solubility in polar solvents. The chloro substituent can influence its reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions. The pyrazole ring contributes to its biological activity, which may include antimicrobial or anti-inflammatory properties, depending on the specific context of its use. Additionally, the presence of the carboxylic acid functional group allows for potential interactions with biological systems, including hydrogen bonding and acid-base reactions. Overall, this compound's unique structure and functional groups make it of interest in medicinal chemistry and material science.
Formula:C10H7ClN2O2
InChI:InChI=1S/C10H7ClN2O2/c11-8-6-7(10(14)15)2-3-9(8)13-5-1-4-12-13/h1-6H,(H,14,15)
InChI key:InChIKey=BENMVTLFAFPIQC-UHFFFAOYSA-N
SMILES:ClC1=C(C=CC(C(O)=O)=C1)N2C=CC=N2
Synonyms:- Benzoic acid, 3-chloro-4-(1H-pyrazol-1-yl)-
- 3-Chloro-4-(1H-pyrazol-1-yl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
