CAS 911312-78-2

2-Methyl-4-(1H-pyrazol-1-yl)benzoic acid

Description:

2-Methyl-4-(1H-pyrazol-1-yl)benzoic acid, with the CAS number 911312-78-2, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a methyl group and a pyrazole ring. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The presence of both the carboxylic acid functional group and the pyrazole ring suggests that it may engage in hydrogen bonding, influencing its reactivity and interactions with other molecules. It may also display acidic properties due to the carboxylic acid group, which can donate protons in solution. Additionally, the pyrazole moiety can contribute to biological activity, making this compound of interest in medicinal chemistry and drug development. Its specific applications and behavior in various chemical environments would depend on further studies, including its synthesis, stability, and potential interactions with biological targets.

Formula: C₁₁H₁₀N₂O₂

InChI: InChI=1S/C11H10N2O2/c1-8-7-9(13-6-2-5-12-13)3-4-10(8)11(14)15/h2-7H,1H3,(H,14,15)

InChI key: InChIKey=OKSFDDKZYBYTOL-UHFFFAOYSA-N

SMILES: CC=1C=C(C=CC1C(O)=O)N2C=CC=N2

Synonyms:

• Benzoic acid, 2-methyl-4-(1H-pyrazol-1-yl)-
• 2-Methyl-4-(1H-pyrazol-1-yl)benzoic acid

2-Methyl-4-(1H-pyrazol-1-yl)benzoic acid

CAS: 911312-78-2

2-Methyl-4-(1H-pyrazol-1-yl)benzoic acid

Purity: 95%

Molecular weight: 202.21g/mol

Ref: 54-OR1045743