CymitQuimica logo

CAS 91133-72-1

:

methyl 5-(acetylamino)-2-methylbenzoate

Description:
Methyl 5-(acetylamino)-2-methylbenzoate, with the CAS number 91133-72-1, is an organic compound that belongs to the class of benzoates. It features a methyl ester functional group, which contributes to its solubility in organic solvents. The presence of the acetylamino group indicates that it has both amine and carbonyl functionalities, which can influence its reactivity and potential applications in organic synthesis. This compound typically exhibits moderate polarity due to the combination of hydrophobic aromatic and hydrophilic functional groups. It may participate in various chemical reactions, such as acylation and nucleophilic substitutions, making it useful in the synthesis of pharmaceuticals and agrochemicals. Additionally, its structural characteristics suggest potential biological activity, although specific biological properties would require further investigation. Overall, methyl 5-(acetylamino)-2-methylbenzoate is a versatile compound with applications in chemical research and development.
Formula:C11H13NO3
InChI:InChI=1/C11H13NO3/c1-7-4-5-9(12-8(2)13)6-10(7)11(14)15-3/h4-6H,1-3H3,(H,12,13)
SMILES:Cc1ccc(cc1C(=O)OC)N=C(C)O
Synonyms:
  • Methyl 5-Acetamido-2-Methylbenzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.