CymitQuimica logo

CAS 911372-78-6

:

Benzonitrile, 4-[(1R)-1-aminoethyl]-, hydrochloride (1:1)

Description:
Benzonitrile, 4-[(1R)-1-aminoethyl]-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a benzonitrile moiety and an aminoethyl group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications. The presence of the amino group suggests potential for biological activity, making it of interest in pharmaceutical research. The compound's molecular structure includes a benzene ring substituted with a nitrile group and an aminoethyl side chain, which can influence its reactivity and interaction with biological systems. As a hydrochloride salt, it is likely to exhibit properties such as increased stability and ease of handling compared to its free base form. Additionally, the compound may participate in hydrogen bonding due to the amino group, affecting its solubility and interaction with other molecules. Overall, this compound's unique characteristics make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C9H10N2·ClH
InChI:InChI=1S/C9H10N2.ClH/c1-7(11)9-4-2-8(6-10)3-5-9;/h2-5,7H,11H2,1H3;1H/t7-;/m1./s1
InChI key:InChIKey=KZLPYAMQKGFHBF-OGFXRTJISA-N
SMILES:[C@H](C)(N)C1=CC=C(C#N)C=C1.Cl
Synonyms:
  • Benzonitrile, 4-[(1R)-1-aminoethyl]-, monohydrochloride
  • (R)-4-(1-Aminoethyl)benzonitrile hydrochloride
  • Benzonitrile, 4-[(1R)-1-aminoethyl]-, hydrochloride (1:1)
Found 5 products.