CymitQuimica logo

CAS 911397-83-6

:

1-Ethyl-4-(4-pentyn-1-yl)piperazine

Description:
1-Ethyl-4-(4-pentyn-1-yl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features an ethyl group and a pentynyl substituent, contributing to its unique properties. The presence of the alkyne functional group (the pentynyl chain) introduces reactivity, making it potentially useful in various synthetic applications. The piperazine structure often imparts basicity and can participate in hydrogen bonding, influencing its solubility and interaction with biological systems. This compound may exhibit pharmacological activity due to its structural similarity to other biologically active piperazine derivatives. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise evaluation. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the alkyne group, which can be reactive under certain conditions.
Formula:C11H20N2
InChI:InChI=1S/C11H20N2/c1-3-5-6-7-13-10-8-12(4-2)9-11-13/h1H,4-11H2,2H3
InChI key:InChIKey=XPEKRCWANCNGTO-UHFFFAOYSA-N
SMILES:C(CCC#C)N1CCN(CC)CC1
Synonyms:
  • 1-Ethyl-4-(pent-4-ynyl)piperazine
  • Piperazine, 1-ethyl-4-(4-pentyn-1-yl)-
  • 1-Ethyl-4-(4-pentyn-1-yl)piperazine
  • Piperazine, 1-ethyl-4-(4-pentynyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.