
CAS 911417-62-4
:2-[3-[4-(1H-Indazol-5-ylamino)-2-quinazolinyl]phenoxy]acetic acid
Description:
2-[3-[4-(1H-Indazol-5-ylamino)-2-quinazolinyl]phenoxy]acetic acid, with CAS number 911417-62-4, is a synthetic organic compound characterized by its complex molecular structure, which includes an indazole moiety and a quinazoline derivative. This compound typically exhibits properties associated with its functional groups, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the phenoxy and acetic acid groups suggests that it may interact with biological targets, possibly influencing pathways related to cell signaling or enzyme inhibition. Its molecular weight, solubility, and stability can vary based on environmental conditions and the presence of solvents. Additionally, the compound may demonstrate specific pharmacological properties, which could include anti-cancer or anti-inflammatory effects, although detailed studies would be necessary to confirm such activities. As with many synthetic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C23H17N5O3
InChI:InChI=1S/C23H17N5O3/c29-21(30)13-31-17-5-3-4-14(11-17)22-26-20-7-2-1-6-18(20)23(27-22)25-16-8-9-19-15(10-16)12-24-28-19/h1-12H,13H2,(H,24,28)(H,29,30)(H,25,26,27)
InChI key:InChIKey=UHUDLFMBGUWKOR-UHFFFAOYSA-N
SMILES:N(C=1C2=C(N=C(N1)C3=CC(OCC(O)=O)=CC=C3)C=CC=C2)C=4C=C5C(=CC4)NN=C5
Synonyms:- 2-[3-[4-[(1H-Indazol-5-yl)amino]quinazolin-2-yl]phenoxy]acetic acid
- 2-[3-[4-(1H-Indazol-5-ylamino)-2-quinazolinyl]phenoxy]acetic acid
- Acetic acid, [3-[4-(1H-indazol-5-ylamino)-2-quinazolinyl]phenoxy]-
- Acetic acid, 2-[3-[4-(1H-indazol-5-ylamino)-2-quinazolinyl]phenoxy]-
- 2-(3-(4-((2H-Indazol-5-yl)amino)quinazolin-2-yl)phenoxy)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
