
CAS 911426-09-0
:(αS)-3,5-Dibromo-α-methylbenzenemethanamine
Description:
(αS)-3,5-Dibromo-α-methylbenzenemethanamine, with the CAS number 911426-09-0, is a chemical compound characterized by its specific stereochemistry and functional groups. It features a benzene ring substituted with two bromine atoms at the 3 and 5 positions, as well as an α-methyl group and an amine functional group. The presence of bromine atoms contributes to its potential reactivity and influences its physical properties, such as solubility and boiling point. The amine group indicates that the compound can participate in hydrogen bonding, which may affect its interactions with other molecules. Additionally, the stereochemistry denoted by (αS) suggests that the compound has a specific spatial arrangement, which can impact its biological activity and reactivity. Overall, this compound may be of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features and potential applications.
Formula:C8H9Br2N
InChI:InChI=1S/C8H9Br2N/c1-5(11)6-2-7(9)4-8(10)3-6/h2-5H,11H2,1H3/t5-/m0/s1
InChI key:InChIKey=DWZJEVRHNGHMTL-YFKPBYRVSA-N
SMILES:[C@@H](C)(N)C1=CC(Br)=CC(Br)=C1
Synonyms:- Benzenemethanamine, 3,5-dibromo-α-methyl-, (αS)-
- (1S)-1-(3,5-Dibromophenyl)ethanamine
- (1S)-1-(3,5-Dibromophenyl)ethan-1-amine
- (αS)-3,5-Dibromo-α-methylbenzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.