CAS 91143-72-5

3-(4-Acetylphenoxy)propanoic acid

Description:

3-(4-Acetylphenoxy)propanoic acid, with the CAS number 91143-72-5, is an organic compound characterized by its structure, which includes a propanoic acid moiety linked to a 4-acetylphenoxy group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities. It is likely to be a white to off-white solid at room temperature, with moderate solubility in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the acetyl group suggests that it may participate in various chemical reactions, including esterification and acylation. Additionally, the phenoxy group can influence the compound's reactivity and potential applications in pharmaceuticals or agrochemicals. Its molecular structure may confer specific biological activities, making it of interest in medicinal chemistry. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₁H₁₂O₄

InChI: InChI=1S/C11H12O4/c1-8(12)9-2-4-10(5-3-9)15-7-6-11(13)14/h2-5H,6-7H2,1H3,(H,13,14)

InChI key: InChIKey=JQVGZRZJTCMBDQ-UHFFFAOYSA-N

SMILES: O(CCC(O)=O)C1=CC=C(C(C)=O)C=C1

Synonyms:

• 3-(4-Acetylphenoxy)propionic acid
• 3-(4-Acetylphenoxy)propanoic acid
• Propionic acid, 3-(p-acetylphenoxy)-
• Propanoic acid, 3-(4-acetylphenoxy)-

3-(4-Acetylphenoxy)propanoic acid

CAS: 91143-72-5

Versatile small molecule scaffold

Formula: C₁₁H₁₂O₄

Purity: Min. 95%

Molecular weight: 208.21 g/mol

Ref: 3D-RDA14372