CymitQuimica logo

CAS 911434-05-4

:

5-Bromo-2-methyl-3-nitropyridine

Description:
5-Bromo-2-methyl-3-nitropyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a bromine atom at the 5-position, a methyl group at the 2-position, and a nitro group at the 3-position of the pyridine ring. The presence of these substituents contributes to its unique chemical properties, including its reactivity and potential applications in various fields such as pharmaceuticals and agrochemicals. The bromine atom can participate in nucleophilic substitution reactions, while the nitro group can serve as a functional group for further chemical transformations. Additionally, the compound's molecular structure influences its solubility, stability, and interaction with biological systems. As with many nitro-substituted compounds, 5-Bromo-2-methyl-3-nitropyridine may exhibit specific biological activities, making it of interest in medicinal chemistry. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds.
Formula:C6H5BrN2O2
InChI:InChI=1S/C6H5BrN2O2/c1-4-6(9(10)11)2-5(7)3-8-4/h2-3H,1H3
InChI key:InChIKey=FZZLWWNOYMHSIS-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)N=CC(Br)=C1
Synonyms:
  • 5-Bromo-3-nitro-α-picoline
  • Pyridine, 5-Bromo-2-Methyl-3-Nitro-
  • T6Nj B1 Cnw Ee
  • 5-Bromo-2-methyl-3-nitropyridine
Found 6 products.