CAS 91159-73-8

4,5-dimethyl-1H-pyrazol-3-amine

Description:

4,5-Dimethyl-1H-pyrazol-3-amine is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two nitrogen atoms at positions 1 and 2. This compound features two methyl groups attached to the 4 and 5 positions of the pyrazole ring, contributing to its unique properties. The amine functional group at the 3 position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine group. The compound is of interest in medicinal chemistry and material science, where it may serve as a building block for more complex molecules or as a ligand in coordination chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅H₉N₃

InChI: InChI=1/C5H9N3/c1-3-4(2)7-8-5(3)6/h1-2H3,(H3,6,7,8)

SMILES: Cc1c(C)[nH][nH]c1=N

Synonyms:

• 1H-pyrazol-3-amine, 4,5-dimethyl-

4,5-Dimethyl-1H-pyrazol-3-amine

CAS: 91159-73-8

Formula: C₅H₉N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 111.1451

Ref: IN-DA003IIY

4,5-Dimethyl-1H-pyrazol-3-amine

CAS: 91159-73-8

4,5-Dimethyl-1H-pyrazol-3-amine

Purity: 98%

Molecular weight: 111.15g/mol

Ref: 54-OR79467

4,5-Dimethyl-1H-pyrazol-3-amine

CAS: 91159-73-8

Formula: C₅H₉N₃

Purity: 95%

Color and Shape: Solid, Brown powder

Molecular weight: 111.148

Ref: 10-F227941