
CAS 911643-92-0
:2-(1-Piperazinyl)-4-thiazolecarboxylic acid
Description:
2-(1-Piperazinyl)-4-thiazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and a piperazine moiety. The thiazole ring contributes to its heterocyclic nature, while the piperazine group enhances its potential for biological activity, particularly in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid functional group. The carboxylic acid functionality can participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. Additionally, the presence of nitrogen atoms in both the piperazine and thiazole structures may contribute to its pharmacological properties, making it a candidate for research in drug development. Its CAS number, 911643-92-0, allows for precise identification in chemical databases, facilitating further studies on its synthesis, properties, and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H11N3O2S
InChI:InChI=1S/C8H11N3O2S/c12-7(13)6-5-14-8(10-6)11-3-1-9-2-4-11/h5,9H,1-4H2,(H,12,13)
InChI key:InChIKey=WNJWHEQEMFRZMT-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N=C(SC1)N2CCNCC2
Synonyms:- 2-(1-Piperazinyl)-4-thiazolecarboxylic acid
- 2-(Piperazin-1-yl)-1,3-thiazole-4-carboxylic acid
- 4-Thiazolecarboxylic acid, 2-(1-piperazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.