CAS 911673-07-9
:(3S,4S,5R,6R)-2-(hydroxymethyl)-6-methoxy-tetrahydropyran-3,4,5-triol; propan-2-ol
Description:
The chemical substance with the name "(3S,4S,5R,6R)-2-(hydroxymethyl)-6-methoxy-tetrahydropyran-3,4,5-triol; propan-2-ol" and CAS number "911673-07-9" is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple hydroxyl (-OH) groups, indicating it is a polyol, which contributes to its hydrophilic nature and potential solubility in water. The presence of a methoxy group (-OCH3) suggests it may exhibit unique reactivity and interactions in various chemical environments. The stereochemistry, denoted by the specific configuration at the chiral centers (3S, 4S, 5R, 6R), implies that the compound can exist in a specific three-dimensional arrangement, which can significantly influence its biological activity and interactions with other molecules. Additionally, the inclusion of propan-2-ol indicates that it may have applications in solvent systems or as a reagent in organic synthesis. Overall, this compound's structural features suggest potential utility in pharmaceuticals or biochemistry.
Formula:C10H22O7
InChI:InChI=1/C7H14O6.C3H8O/c1-12-7-6(11)5(10)4(9)3(2-8)13-7;1-3(2)4/h3-11H,2H2,1H3;3-4H,1-2H3/t3?,4-,5+,6-,7-;/m1./s1
Synonyms:- Methyl -D-Mannopyranoside 2-Propanol
- Methyl -D-Mannopyranoside Isopropylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl β-D-mannopyranoside isopropylate
CAS:Methyl β-D-mannopyranoside isopropylateFormula:C7H14O6·(CH3)2CHOHPurity:>98%Color and Shape: white solidMolecular weight:254.28g/molMethyl β-D-Mannopyranoside Isopropylate
CAS:Controlled ProductFormula:C7H14O6·C3H8OColor and Shape:NeatMolecular weight:254.28Methyl β-D-mannopyranoside isopropylate
CAS:Controlled Product<p>Methyl b-D-mannopyranoside isopropylate is a high purity synthetic oligosaccharide. It has been custom synthesized and fluorinated with methyl groups on the sugar ring. It can be used for glycosylation, modification, and synthesis of saccharides. This product can also be used as a complex carbohydrate in the food industry.</p>Formula:C7H14O6•C3H8OPurity:Min. 95%Color and Shape:White PowderMolecular weight:254.28 g/mol



