CymitQuimica logo

CAS 911705-42-5

:

6-(Bromomethyl)-4-(3-methoxypropyl)-2H-1,4-benzoxazin-3(4H)-one

Description:
6-(Bromomethyl)-4-(3-methoxypropyl)-2H-1,4-benzoxazin-3(4H)-one, with the CAS number 911705-42-5, is a synthetic organic compound characterized by its complex structure, which includes a benzoxazine ring. This compound features a bromomethyl group and a methoxypropyl substituent, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom makes it a suitable candidate for nucleophilic substitution reactions, while the methoxypropyl group may enhance solubility in organic solvents. The benzoxazine moiety is known for its thermal stability and potential use in polymer chemistry, particularly in the development of thermosetting resins. Additionally, compounds of this class may exhibit biological activity, making them of interest in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, this compound represents a versatile building block in chemical synthesis and materials science.
Formula:C13H16BrNO3
InChI:InChI=1S/C13H16BrNO3/c1-17-6-2-5-15-11-7-10(8-14)3-4-12(11)18-9-13(15)16/h3-4,7H,2,5-6,8-9H2,1H3
InChI key:InChIKey=YYYPUGIQQUSTSA-UHFFFAOYSA-N
SMILES:C(CCOC)N1C=2C(=CC=C(CBr)C2)OCC1=O
Synonyms:
  • 6-(Bromomethyl)-4-(3-methoxypropyl)-2H-1,4-benzoxazin-3(4H)-one
  • 6-(Bromomethyl)-4-(3-methoxypropyl)-2H-benzo[b][1,4]oxazin-3(4H)-one
  • 6-Bromomethyl-4-(3-methoxypropyl)-4H-benzo[1,4]oxazin-3-one
  • 2H-1,4-Benzoxazin-3(4H)-one, 6-(bromomethyl)-4-(3-methoxypropyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.