
CAS 91177-60-5
:(1α,2′aR,4α)-2′a,3′,4′,5′-Tetrahydrospiro[cyclohexane-1,1′(2′H)-cyclopenta[ij][1,3]dioxolo[4,5-g]isoquinolin]-4-ol
Description:
The chemical substance known as "(1α,2′aR,4α)-2′a,3′,4′,5′-Tetrahydrospiro[cyclohexane-1,1′(2′H)-cyclopenta[ij][1,3]dioxolo[4,5-g]isoquinolin]-4-ol" with the CAS number 91177-60-5 is a complex organic compound characterized by its unique spirocyclic structure. This compound features a bicyclic framework that includes a cyclohexane and a cyclopenta[dioxolo] moiety, contributing to its distinctive three-dimensional shape. The presence of multiple stereocenters indicates that it may exhibit chirality, which can influence its biological activity and interactions. The hydroxyl (-OH) functional group suggests potential for hydrogen bonding, which may enhance solubility in polar solvents and affect its reactivity. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties. However, detailed studies on its specific biological effects, synthesis methods, and applications would be necessary to fully understand its significance in chemical and pharmaceutical contexts.
Formula:C17H21NO3
InChI:InChI=1S/C17H21NO3/c19-11-1-4-17(5-2-11)8-12-14-10(3-6-18-12)7-13-16(15(14)17)21-9-20-13/h7,11-12,18-19H,1-6,8-9H2
InChI key:InChIKey=KWWQMZNQWSVKHN-UHFFFAOYSA-N
SMILES:OC1CCC2(C=3C=4C(C2)NCCC4C=C5C3OCO5)CC1
Synonyms:- Spiro[cyclohexane-1,1′(2′H)-cyclopenta[ij][1,3]dioxolo[4,5-g]isoquinolin]-4-ol, 2′a,3′,4′,5′-tetrahydro-, [1(R)-cis]-
- (1α,2′aR,4α)-2′a,3′,4′,5′-Tetrahydrospiro[cyclohexane-1,1′(2′H)-cyclopenta[ij][1,3]dioxolo[4,5-g]isoquinolin]-4-ol
- 10-Epilitsericine
- Lauformine
- Spiro[cyclohexane-1,1′(2′H)-cyclopenta[ij][1,3]dioxolo[4,5-g]isoquinolin]-4-ol, 2′a,3′,4′,5′-tetrahydro-, (1α,2′aR,4α)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lauformine
CAS:<p>Lauformine is a isoquinoline alkaloid.</p>Formula:C17H21NO3Color and Shape:SolidMolecular weight:287.359
