CAS 911788-36-8
:1-(1,3-dimethyl-1H-pyrazol-4-yl)ethanamine
Description:
1-(1,3-Dimethyl-1H-pyrazol-4-yl)ethanamine, with the CAS number 911788-36-8, is an organic compound characterized by its pyrazole ring structure, which contributes to its biological activity. This compound features a 1,3-dimethyl substitution on the pyrazole ring, enhancing its lipophilicity and potentially influencing its interaction with biological targets. The ethanamine moiety introduces an amine functional group, which can participate in hydrogen bonding and may affect the compound's solubility and reactivity. Typically, compounds of this nature are studied for their pharmacological properties, including potential applications in medicinal chemistry. The presence of both the pyrazole and amine groups suggests that it may exhibit diverse biological activities, possibly acting as a ligand for various receptors or enzymes. Additionally, the compound's stability, reactivity, and solubility in different solvents can vary based on its structural features, making it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C7H13N3
InChI:InChI=1/C7H13N3/c1-5(8)7-4-10(3)9-6(7)2/h4-5H,8H2,1-3H3
SMILES:CC(c1cn(C)nc1C)N
Synonyms:- 1H-Pyrazole-4-methanamine, alpha,1,3-trimethyl-
- 1-(1,3-Dimethyl-1H-pyrazol-4-yl)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
