CAS 911806-67-2

Ethyl 4,5-dimethyl-2-pyridinecarboxylate

Description:

Ethyl 4,5-dimethyl-2-pyridinecarboxylate is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two methyl groups at the 4 and 5 positions of the pyridine ring, contributing to its unique chemical properties and potential reactivity. The ethyl ester functional group at the 2-position enhances its solubility in organic solvents and may influence its reactivity in various chemical reactions, such as esterification or nucleophilic substitution. Ethyl 4,5-dimethyl-2-pyridinecarboxylate is likely to exhibit moderate polarity due to the presence of both the pyridine nitrogen and the ester group, making it a suitable candidate for applications in organic synthesis and medicinal chemistry. Its specific physical properties, such as boiling point, melting point, and density, would depend on the molecular interactions and the overall structure. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1S/C10H13NO2/c1-4-13-10(12)9-5-7(2)8(3)6-11-9/h5-6H,4H2,1-3H3

InChI key: InChIKey=KHYVNFSUMMEGSS-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CC(C)=C(C)C=N1

Synonyms:

• Ethyl 4,5-dimethyl-2-pyridinecarboxylate
• 2-Pyridinecarboxylic acid, 4,5-dimethyl-, ethyl ester
• Ethyl 4,5-dimethylpicolinate