CAS 91182-00-2
:ethyl 4-(ethylamino)-3-nitrobenzoate
Description:
Ethyl 4-(ethylamino)-3-nitrobenzoate, with the CAS number 91182-00-2, is an organic compound characterized by its ester functional group and the presence of both an ethylamino and a nitro group on the aromatic ring. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It is soluble in organic solvents, which is common for esters, but may have limited solubility in water due to its hydrophobic characteristics. The presence of the nitro group contributes to its potential reactivity and may influence its electronic properties, making it useful in various chemical syntheses. Ethyl 4-(ethylamino)-3-nitrobenzoate may also exhibit biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as compounds with nitro groups can sometimes be sensitive to heat or shock. Overall, this compound is significant in organic chemistry and may have applications in medicinal chemistry or as an intermediate in the synthesis of other chemical entities.
Formula:C11H14N2O4
InChI:InChI=1/C11H14N2O4/c1-3-12-9-6-5-8(11(14)17-4-2)7-10(9)13(15)16/h5-7,12H,3-4H2,1-2H3
SMILES:CCNc1ccc(cc1N(=O)=O)C(=O)OCC
Synonyms:- 4-Ethylamino-3-nitro-benzoic acid ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Ethylamino-3-nitro-benzoic acid ethyl ester
CAS:<p>4-Ethylamino-3-nitro-benzoic acid ethyl ester is a crystalline solid that belongs to the class of organic compounds known as benzamides. It has a molecular formula of C 7 H 6 N 2 O 3 and a molecular weight of 166.14 g/mol. 4-Ethylamino-3-nitro-benzoic acid ethyl ester has an intramolecular conformation, which means that the structure is stable when it is not interacting with other molecules. The molecule consists of six carbon atoms and six hydrogen atoms in a chain and a six-membered ring containing two nitrogens, one oxygen, and four carbons. The molecule also contains an amino group (-NH2) attached to the second carbon atom in the chain and an ethyl group (-CH2CH3) attached to the third carbon atom in the chain. This compound interacts with hydrogen bonds to form weak bonds between molecules, which stabil</p>Formula:C11H14N2O4Purity:Min. 95%Molecular weight:238.24 g/mol

