CymitQuimica logo

CAS 91182-77-3

:

3-methyl-5-phenyl-4-isoxazolecarbonyl chloride

Description:
3-Methyl-5-phenyl-4-isoxazolecarbonyl chloride, with the CAS number 91182-77-3, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, particularly acylation. The presence of the methyl and phenyl substituents on the isoxazole ring contributes to its unique chemical properties, potentially influencing its reactivity and solubility. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. Additionally, the carbonyl chloride group indicates that it can release hydrochloric acid upon hydrolysis, which is a consideration for handling and storage. Overall, 3-methyl-5-phenyl-4-isoxazolecarbonyl chloride is a versatile compound with applications in organic synthesis and medicinal chemistry, although specific applications would depend on further research into its biological and chemical behavior.
Formula:C11H8ClNO2
InChI:InChI=1/C11H8ClNO2/c1-7-9(11(12)14)10(15-13-7)8-5-3-2-4-6-8/h2-6H,1H3
SMILES:Cc1c(c(c2ccccc2)on1)C(=O)Cl
Synonyms:
  • 3-Methyl-5-Phenylisoxazole-4-Carbonyl Chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.