
CAS 911825-90-6
:2-Chloro-α-methyl-3-pyridinemethanamine
Description:
2-Chloro-α-methyl-3-pyridinemethanamine, with the CAS number 911825-90-6, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloro substituent at the second position and an α-methyl group, indicating that a methyl group is attached to the carbon adjacent to the nitrogen in the pyridine ring. The presence of the amine functional group contributes to its basicity and potential reactivity in various chemical reactions. This compound may exhibit properties typical of amines, such as the ability to form hydrogen bonds and participate in nucleophilic substitution reactions. Its specific applications and behavior in biological systems or synthetic pathways would depend on its structural characteristics and functional groups. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with exposure.
Formula:C7H9ClN2
InChI:InChI=1S/C7H9ClN2/c1-5(9)6-3-2-4-10-7(6)8/h2-5H,9H2,1H3
InChI key:InChIKey=KRRJPKWZJVRTPE-UHFFFAOYSA-N
SMILES:C(C)(N)C1=C(Cl)N=CC=C1
Synonyms:- 1-(2-Chloro-pyridin-3-yl)-ethylamine
- 3-Pyridinemethanamine, 2-chloro-α-methyl-
- 3-(1-Aminoethyl)-2-chloropyridine
- 2-Chloro-α-methyl-3-pyridinemethanamine
- 1-(2-Chloropyridin-3-yl)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.