CAS 91187-89-2
:N-Cyclopropyl-3-pyrrolidinemethanamine
Description:
N-Cyclopropyl-3-pyrrolidinemethanamine, identified by its CAS number 91187-89-2, is a chemical compound characterized by its unique structure that includes a cyclopropyl group and a pyrrolidine ring. This compound is classified as an amine, which typically indicates the presence of a nitrogen atom bonded to carbon atoms. The cyclopropyl group contributes to its rigidity and may influence its reactivity and interaction with biological systems. N-Cyclopropyl-3-pyrrolidinemethanamine is of interest in medicinal chemistry, particularly for its potential pharmacological properties, which may include effects on neurotransmitter systems. Its molecular structure suggests that it could interact with various receptors, making it a candidate for research in areas such as neuropharmacology. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of functional groups and the overall molecular conformation. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation.
Formula:C8H16N2
InChI:InChI=1S/C8H16N2/c1-2-8(1)10-6-7-3-4-9-5-7/h7-10H,1-6H2
InChI key:InChIKey=ODXGUKYYNHKQBC-UHFFFAOYSA-N
SMILES:N(CC1CCNC1)C2CC2
Synonyms:- 3-Pyrrolidinemethanamine, N-cyclopropyl-
- N-Cyclopropyl-3-pyrrolidinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
