CAS 91188-15-7
:3-(N-Boc-aminomethyl)azetidine
Description:
3-(N-Boc-aminomethyl)azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the N-Boc (tert-butoxycarbonyl) group indicates that this compound is likely used in organic synthesis, particularly in the context of protecting amines during chemical reactions. The Boc group is a common protecting group that enhances the stability of the amine functionality while allowing for selective reactions to occur at other sites on the molecule. This compound is typically a white to off-white solid and is soluble in polar organic solvents. Its applications may include use in pharmaceutical chemistry, particularly in the synthesis of biologically active compounds or intermediates. The azetidine ring can impart unique steric and electronic properties, making it a valuable scaffold in medicinal chemistry. As with many chemical substances, handling should be done with care, following appropriate safety protocols due to potential reactivity and toxicity.
Formula:C9H19ClN2O2
InChI:InChI=1/C9H18N2O2.ClH/c1-9(2,3)13-8(12)7-4-11(5-7)6-10;/h7H,4-6,10H2,1-3H3;1H
SMILES:CC(C)(C)OC(=O)C1CN(C1)CN.Cl
Synonyms:- 3-(N-tert-Butoxycarbonylaminomethyl)azetidine
- Tert-Butyl Azetidin-3-Ylmethyl(Methyl)Carbamate
- Tert-Butyl (Azetidin-3-Ylmethyl)Carbamate
- tert-butyl N-(azetidin-3-ylmethyl)carbamate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(Boc-aminomethyl)azetidine hydrochloride, 95%
CAS:It is a useful building block in the synthesis of polypeptides and other nitrogen containing compounds with potential biological properties. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer toFormula:C9H18N2O2•HClPurity:95%Molecular weight:222.713-(N-Boc-aminomethyl)azetidine
CAS:Formula:C9H18N2O2Purity:97%Color and Shape:SolidMolecular weight:186.25143-(Aminomethyl)azetidine, 3-BOC protected
CAS:3-(Aminomethyl)azetidine, 3-BOC protectedFormula:C9H18N2O2Purity:97%Color and Shape: white solidMolecular weight:186.25g/mol3-Boc-aminomethyl-azetidine
CAS:Formula:C9H18N2O2Purity:95.0%Color and Shape:SolidMolecular weight:186.255



