CAS 91189-07-0

N-[(1-benzylpyrrolidin-3-yl)methyl]ethanamine

Description:

N-[(1-benzylpyrrolidin-3-yl)methyl]ethanamine, with the CAS number 91189-07-0, is a chemical compound that belongs to the class of amines. It features a pyrrolidine ring substituted with a benzyl group and an ethylamine moiety, which contributes to its structural complexity. This compound is characterized by its potential biological activity, particularly in the context of neuropharmacology, as it may interact with neurotransmitter systems. The presence of the benzyl group enhances lipophilicity, which can influence its ability to cross biological membranes. Additionally, the amine functional group can participate in hydrogen bonding, affecting solubility and reactivity. While specific applications and effects may vary, compounds of this nature are often studied for their potential therapeutic uses, including in the treatment of neurological disorders. Safety and handling precautions are essential when working with such substances, as they may exhibit varying degrees of toxicity and require proper laboratory protocols.

Formula: C₁₄H₂₂N₂

InChI: InChI=1/C14H22N2/c1-2-15-10-14-8-9-16(12-14)11-13-6-4-3-5-7-13/h3-7,14-15H,2,8-12H2,1H3

SMILES: CCNCC1CCN(Cc2ccccc2)C1

N-((1-Benzylpyrrolidin-3-yl)methyl)ethanamine

CAS: 91189-07-0

Formula: C₁₄H₂₂N₂

Molecular weight: 218.3379

Ref: IN-DA00GUVM

[(1-Benzylpyrrolidin-3-yl)methyl](ethyl)amine

CAS: 91189-07-0

Versatile small molecule scaffold

Formula: C₁₄H₂₂N₂

Purity: Min. 95%

Molecular weight: 218.34 g/mol

Ref: 3D-RDA18907