
CAS 91189-10-5
:5-Oxo-1-(phenylmethyl)-N-propyl-3-pyrrolidinecarboxamide
Description:
5-Oxo-1-(phenylmethyl)-N-propyl-3-pyrrolidinecarboxamide, with the CAS number 91189-10-5, is a chemical compound that belongs to the class of pyrrolidine derivatives. This substance features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is characterized by the presence of a carboxamide functional group. The compound has a phenylmethyl substituent, indicating the presence of a benzyl group attached to the nitrogen atom of the pyrrolidine ring, as well as a propyl group, which contributes to its overall hydrophobic character. The presence of the oxo group (a carbonyl group) at the 5-position of the pyrrolidine ring suggests potential reactivity and interactions in biological systems. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. However, specific biological activities, solubility, and stability characteristics would require further investigation through experimental studies.
Formula:C15H20N2O2
InChI:InChI=1S/C15H20N2O2/c1-2-8-16-15(19)13-9-14(18)17(11-13)10-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3,(H,16,19)
InChI key:InChIKey=GHXAYOVKQMHCAF-UHFFFAOYSA-N
SMILES:C(N1CC(C(NCCC)=O)CC1=O)C2=CC=CC=C2
Synonyms:- 3-Pyrrolidinecarboxamide, 5-oxo-1-(phenylmethyl)-N-propyl-
- 5-Oxo-1-(phenylmethyl)-N-propyl-3-pyrrolidinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.