CymitQuimica logo

CAS 91189-24-1

:

2-methyl-2,7-diazaspiro[4.4]nonane-1,3,8-trione

Description:
2-Methyl-2,7-diazaspiro[4.4]nonane-1,3,8-trione is a chemical compound characterized by its unique spirocyclic structure, which includes two nitrogen atoms integrated into a bicyclic framework. This compound features a trione functional group, indicating the presence of three carbonyl (C=O) groups, which significantly influence its reactivity and potential applications. The presence of the methyl group contributes to its steric properties and may affect its solubility and interaction with other molecules. The spiro structure often imparts interesting conformational characteristics, which can be relevant in medicinal chemistry and material science. Additionally, the nitrogen atoms in the structure can participate in hydrogen bonding, potentially enhancing its biological activity or interaction with other chemical species. Overall, 2-methyl-2,7-diazaspiro[4.4]nonane-1,3,8-trione is a compound of interest for further study in various fields, including organic synthesis and pharmacology, due to its distinctive structural features and functional groups.
Formula:C8H10N2O3
InChI:InChI=1/C8H10N2O3/c1-10-6(12)3-8(7(10)13)2-5(11)9-4-8/h2-4H2,1H3,(H,9,11)
Synonyms:
  • 2-Methyl-2,7-diazaspiro[4.4]nonan-1,3,8-trion
  • 2,7-diazaspiro[4.4]nonane-1,3,8-trione, 2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.