CAS 91192-32-4

2-Hydroxy-6-methoxyquinoxaline

Description:

2-Hydroxy-6-methoxyquinoxaline is an organic compound characterized by its quinoxaline structure, which consists of a fused bicyclic system containing two nitrogen atoms. This compound features a hydroxyl group (-OH) at the 2-position and a methoxy group (-OCH3) at the 6-position, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the hydroxyl group. The compound is of interest in various fields, including medicinal chemistry, due to its potential pharmacological properties, such as neuroprotective effects or activity against certain diseases. Its molecular structure allows for interactions with biological targets, making it a candidate for further research in drug development. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of 2-Hydroxy-6-methoxyquinoxaline may vary.

Formula: C₉H₈N₂O₂

InChI: InChI=1/C9H8N2O2/c1-13-6-2-3-7-8(4-6)10-5-9(12)11-7/h2-5H,1H3,(H,11,12)

SMILES: COc1ccc2c(c1)ncc(=O)[nH]2

Synonyms:

• 6-methoxyquinoxalin-2(1H)-one

6-Methoxy-1H-quinoxalin-2-one

CAS: 91192-32-4

Formula: C₉H₈N₂O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 176.1720

Ref: IN-DA00IGJ5

6-Methoxyquinoxalin-2(1H)-one

CAS: 91192-32-4

Purity: 95.0%

Molecular weight: 176.1750030517578

Ref: 10-F220519