CAS 91192-36-8

N-1,3-benzothiazol-2-ylglycine

Description:

N-1,3-benzothiazol-2-ylglycine, with the CAS number 91192-36-8, is an organic compound characterized by its unique structure that combines a benzothiazole moiety with a glycine group. This compound typically exhibits properties such as moderate solubility in polar solvents and potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The presence of the benzothiazole ring contributes to its aromatic characteristics and may influence its reactivity and interaction with biological systems. Additionally, the glycine component can impart certain functional properties, such as the ability to participate in hydrogen bonding and act as a zwitterion under specific conditions. Overall, N-1,3-benzothiazol-2-ylglycine is notable for its potential applications in medicinal chemistry and its role in the development of bioactive compounds. Further studies are often conducted to explore its specific biological activities and mechanisms of action.

Formula: C₉H₈N₂O₂S

InChI: InChI=1/C9H8N2O2S/c12-8(13)5-10-9-11-6-3-1-2-4-7(6)14-9/h1-4H,5H2,(H,10,11)(H,12,13)

SMILES: c1ccc2c(c1)[nH]c(=NCC(=O)O)s2

Synonyms:

• glycine, N-2-benzothiazolyl-
• N-2-Benzothiazolylglycine

2-[(1,3-Benzothiazol-2-yl)amino]acetic acid

CAS: 91192-36-8

Versatile small molecule scaffold

Formula: C₉H₈N₂O₂S

Purity: Min. 95%

Molecular weight: 208.24 g/mol

Ref: 3D-RDA19236