CAS 91201-84-2
:1H-Indole-5-carbonitrile, homopolymer
Description:
1H-Indole-5-carbonitrile, homopolymer, identified by CAS number 91201-84-2, is a synthetic polymer derived from the polymerization of indole-5-carbonitrile monomers. This compound exhibits characteristics typical of polymers, including high molecular weight and a complex structure that can influence its physical and chemical properties. The presence of the indole moiety contributes to its potential for unique electronic and optical properties, making it of interest in various applications, including organic electronics and materials science. The nitrile functional group may impart additional reactivity and solubility characteristics, affecting the polymer's interactions with solvents and other materials. Furthermore, the polymer's thermal stability and mechanical properties can vary based on its molecular structure and the conditions under which it was synthesized. Overall, 1H-Indole-5-carbonitrile, homopolymer, represents a versatile material with potential applications in advanced technologies, although specific performance characteristics would depend on its formulation and processing conditions.
Formula:(C9H6N2)x
InChI:InChI=1S/C9H6N2/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5,11H
InChI key:InChIKey=YHYLDEVWYOFIJK-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C2C(=CC1)NC=C2
Synonyms:- Poly(5-cyanoindole)
- 5-Cyanoindole homopolymer
- Indole-5-carbonitrile polymer
- 1H-Indole-5-carbonitrile, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
