CAS 91206-30-3

Furo[2′,3′:4,5]pyrrolo[1,2-d][1,2,4]triazin-8(7H)-one

Description:

Furo[2′,3′:4,5]pyrrolo[1,2-d][1,2,4]triazin-8(7H)-one is a heterocyclic organic compound characterized by its complex fused ring structure, which includes a furo and pyrrolo moiety along with a triazine component. This compound typically exhibits properties associated with heterocycles, such as potential biological activity and solubility in various organic solvents. Its structure suggests the presence of multiple functional groups, which may contribute to its reactivity and interaction with biological systems. The compound is of interest in medicinal chemistry and may possess pharmacological properties, although specific biological activities would depend on further empirical studies. The presence of nitrogen atoms in the triazine ring can influence its electronic properties, making it a candidate for various applications in drug development and materials science. As with many heterocycles, the stability and reactivity of this compound can be influenced by environmental factors such as pH and temperature. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₈H₅N₃O₂

InChI: InChI=1S/C8H5N3O2/c12-8-6-3-7-5(1-2-13-7)11(6)4-9-10-8/h1-4H,(H,10,12)

InChI key: InChIKey=WUFCEYBHMNJZIX-UHFFFAOYSA-N

SMILES: O=C1C=2N(C3=C(C2)OC=C3)C=NN1

Synonyms:

• Furo[2′,3′:4,5]pyrrolo[1,2-d][1,2,4]triazin-8(7H)-one