CAS 91214-06-1
:8-Oxoundecanoic acid
Description:
8-Oxoundecanoic acid, with the CAS number 91214-06-1, is a fatty acid derivative characterized by the presence of a ketone functional group at the eighth carbon of an undecanoic acid chain. This compound typically exhibits properties common to fatty acids, such as being a colorless to pale yellow liquid or solid at room temperature, depending on its specific form and purity. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic hydrocarbon chain. The presence of the ketone group introduces unique reactivity, making it a potential candidate for various chemical reactions, including oxidation and reduction processes. 8-Oxoundecanoic acid may also exhibit biological activity, which could be of interest in fields such as biochemistry and pharmacology. Its applications may extend to the synthesis of surfactants, emulsifiers, or other chemical intermediates. As with many organic compounds, proper handling and safety measures should be observed due to potential health hazards associated with exposure.
Formula:C11H20O3
InChI:InChI=1/C11H20O3/c1-2-7-10(12)8-5-3-4-6-9-11(13)14/h2-9H2,1H3,(H,13,14)
InChI key:InChIKey=BHMVWQCUELPXCR-UHFFFAOYSA-N
SMILES:C(CCCCCC(O)=O)C(CCC)=O
Synonyms:- 8-Oxoundecanoic acid
- Undecanoic acid, 8-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.