CAS 91216-38-5

(5R,9R)-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione

Description:

(5R,9R)-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione, identified by its CAS number 91216-38-5, is a chemical compound characterized by its unique spirocyclic structure, which includes a diaza (two nitrogen atoms) framework. This compound features a bicyclic system that incorporates both carbonyl (C=O) functional groups, contributing to its reactivity and potential biological activity. The presence of multiple methyl groups enhances its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The stereochemistry indicated by the (5R,9R) configuration suggests specific spatial arrangements of its substituents, which can significantly affect its pharmacological properties. Such compounds are often of interest in medicinal chemistry due to their potential as drug candidates, particularly in the development of agents targeting various biological pathways. Overall, the structural complexity and functional groups present in this compound make it a subject of interest for further research in both synthetic and medicinal chemistry.

Formula: C₁₁H₁₈N₂O₂

InChI: InChI=1/C11H18N2O2/c1-7-4-10(2,3)6-11(5-7)8(14)12-9(15)13-11/h7H,4-6H2,1-3H3,(H2,12,13,14,15)/t7-,11-/m1/s1

SMILES: C[C@@H]1CC(C)(C)C[C@]2(C1)C(=NC(=N2)O)O

7,7,9-Trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione

CAS: 91216-38-5

Versatile small molecule scaffold

Formula: C₁₁H₁₈N₂O₂

Purity: Min. 95%

Molecular weight: 210.27 g/mol

Ref: 3D-RDA21638

HC102A

CAS: 91216-38-5

HC102A is an inhibitor of Mycobacterium tuberculosis DosRST signaling and persistence.

Formula: C₁₁H₁₈N₂O₂

Color and Shape: Solid

Molecular weight: 210.27

Ref: TM-T71727