CAS 91221-46-4
:4,4'-(2-phenylbut-1-ene-1,1-diyl)diphenol
Description:
4,4'-(2-phenylbut-1-ene-1,1-diyl)diphenol, with CAS number 91221-46-4, is an organic compound characterized by its structure, which features two phenolic groups connected by a butene linker. This compound exhibits properties typical of phenols, including the ability to form hydrogen bonds due to the hydroxyl (-OH) groups, which can influence its solubility and reactivity. It is likely to be a solid at room temperature, given the presence of multiple aromatic rings that contribute to its stability and melting point. The compound may exhibit antioxidant properties, making it of interest in various applications, including materials science and pharmaceuticals. Additionally, its unique structure may allow for specific interactions in biological systems or materials, potentially leading to applications in drug development or as a polymer additive. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its characteristics and potential uses.
Formula:C22H20O2
InChI:InChI=1/C22H20O2/c1-2-21(16-6-4-3-5-7-16)22(17-8-12-19(23)13-9-17)18-10-14-20(24)15-11-18/h3-15,23-24H,2H2,1H3
SMILES:CCC(=C(c1ccc(cc1)O)c1ccc(cc1)O)c1ccccc1
Synonyms:- Phenol, 4,4'-(2-Phenyl-1-Buten-1-Ylidene)Bis-
- Phenol, 4,4'-(2-phenyl-1-butenylidene)bis-
- 4,4'-(2-Phenylbut-1-ene-1,1-diyl)diphenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,1-bis(4-hydroxyphenyl)-2-phenylbut-1-ene
CAS:Formula:C22H20O2Purity:96%Color and Shape:SolidMolecular weight:316.39301,1-Bis(4-hydroxyphenyl)-2-phenyl-1-butene
CAS:Controlled ProductApplications 1,1-Bis(4-hydroxyphenyl)-2-phenyl-1-butene (cas# 91221-46-4) is a compound useful in organic synthesis.
Formula:C22H20O2Color and Shape:NeatMolecular weight:316.391,1-Bis(4-hydroxyphenyl)-2-phenyl-1-butene
CAS:1,1-Bis(4-hydroxyphenyl)-2-phenyl-1-butene (BPB) is a synthetic compound that is used to treat breast cancer. BPB binds to the estrogen receptor and inhibits the growth of breast cancer cells in culture. It has also been shown to inhibit aromatase, an enzyme that converts androgens into estrogens, thus inhibiting the synthesis of estrogens. BPB has been shown to have antiestrogenic activity in vitro studies and is being studied as a possible treatment for breast cancer in vivo.Formula:C22H20O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:316.39 g/mol



