CymitQuimica logo

CAS 91225-42-2

:

6-Bromo-2-methyl-1H-imidazo[4,5-b]pyrazine

Description:
6-Bromo-2-methyl-1H-imidazo[4,5-b]pyrazine is a heterocyclic compound characterized by its fused imidazole and pyrazine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 6-position and a methyl group at the 2-position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale to light-colored solid form and has a relatively high melting point, indicative of strong intermolecular interactions. It is often used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, its heteroatom content can influence its electronic properties, making it a candidate for studies in materials science and catalysis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C6H5BrN4
InChI:InChI=1S/C6H5BrN4/c1-3-9-5-6(10-3)11-4(7)2-8-5/h2H,1H3,(H,8,9,10,11)
InChI key:InChIKey=WNMMZMFQRGHMCV-UHFFFAOYSA-N
SMILES:CC=1NC=2C(N1)=NC(Br)=CN2
Synonyms:
  • 1H-Imidazo[4,5-b]pyrazine, 5-bromo-2-methyl-
  • 1H-Imidazo[4,5-b]pyrazine, 6-bromo-2-methyl-
  • 6-Bromo-2-methyl-1H-imidazo[4,5-b]pyrazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.