CAS 91225-69-3

2-(chloromethyl)-5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4(3H)-one

Description:

2-(Chloromethyl)-5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4(3H)-one is a heterocyclic compound characterized by its thieno[2,3-d]pyrimidine core, which incorporates both sulfur and nitrogen atoms in its structure. This compound features a chloromethyl group and a para-chlorophenyl substituent, contributing to its potential reactivity and biological activity. The presence of the thieno and pyrimidine rings suggests that it may exhibit interesting pharmacological properties, possibly acting as an inhibitor or modulator in various biochemical pathways. The chlorinated groups can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the compound's structure may allow for various synthetic modifications, making it a candidate for further research in medicinal chemistry. Its CAS number, 91225-69-3, provides a unique identifier for regulatory and safety information, which is essential for handling and application in research and development. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.

Formula: C₁₃H₈Cl₂N₂OS

InChI: InChI=1/C13H8Cl2N2OS/c14-5-10-16-12(18)11-9(6-19-13(11)17-10)7-1-3-8(15)4-2-7/h1-4,6H,5H2,(H,16,17,18)

SMILES: c1cc(ccc1c1csc2c1c(nc(CCl)n2)O)Cl

2-(Chloromethyl)-5-(4-chlorophenyl)-3H,4H-thieno[2,3-d]pyrimidin-4-one

CAS: 91225-69-3

Versatile small molecule scaffold

Formula: C₁₃H₈Cl₂N₂OS

Purity: Min. 95%

Molecular weight: 311.2 g/mol

Ref: 3D-RDA22569