
CAS 912259-11-1
:6,6-dimethyl-6,7-dihydro-1H-indazol-4(5H)-one
Description:
6,6-Dimethyl-6,7-dihydro-1H-indazol-4(5H)-one is a chemical compound characterized by its indazole core, which features a fused bicyclic structure containing both a five-membered and a six-membered ring. This compound has two methyl groups attached to the nitrogen-containing ring, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the carbonyl group in the structure suggests potential reactivity, particularly in nucleophilic addition reactions. This compound may also display biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. As with many organic compounds, the stability and reactivity can be affected by environmental conditions such as pH and temperature. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c1-9(2)3-7-6(5-10-11-7)8(12)4-9/h5H,3-4H2,1-2H3,(H,10,11)
InChI key:LNOAXGPGVISHPB-UHFFFAOYSA-N
SMILES:CC1(CC2=C(C=NN2)C(=O)C1)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery

