CymitQuimica logo

CAS 912284-76-5

:

2-[(2-Amino-4-fluorophenyl)methylamino]ethanol

Description:
2-[(2-Amino-4-fluorophenyl)methylamino]ethanol, with the CAS number 912284-76-5, is an organic compound characterized by its amine and alcohol functional groups. This substance features a fluorinated aromatic ring, which contributes to its unique chemical properties and potential biological activity. The presence of the amino group enhances its solubility in water and its ability to form hydrogen bonds, making it a polar compound. The compound's structure suggests it may exhibit interesting pharmacological properties, potentially acting as a ligand or modulator in biological systems. Its molecular configuration allows for various interactions with biological targets, which could be relevant in medicinal chemistry. Additionally, the fluorine atom can influence the compound's lipophilicity and metabolic stability. As with many amine-containing compounds, it may also exhibit basicity, allowing it to participate in acid-base reactions. Overall, 2-[(2-Amino-4-fluorophenyl)methylamino]ethanol is a compound of interest in both synthetic and medicinal chemistry due to its functional groups and structural characteristics.
Formula:C9H13FN2O
InChI:InChI=1S/C9H13FN2O/c1-12(4-5-13)9-3-2-7(10)6-8(9)11/h2-3,6,13H,4-5,11H2,1H3
InChI key:InChIKey=IBCSYVRZVWETJF-UHFFFAOYSA-N
SMILES:N(CCO)(C)C1=C(N)C=C(F)C=C1
Synonyms:
  • Ethanol, 2-[(2-amino-4-fluorophenyl)methylamino]-
  • 2-(2-Amino-4-fluoro-N-methylanilino)ethanol
  • 2-[(2-Amino-4-fluorophenyl)methylamino]ethanol
  • 2-[(2-Amino-4-fluorophenyl)(methyl)amino]ethan-1-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.