CAS 91233-71-5
:4-(5-Pyrimidinyl)morpholine
Description:
4-(5-Pyrimidinyl)morpholine, with the CAS number 91233-71-5, is a chemical compound characterized by its unique structure that combines a morpholine ring with a pyrimidine moiety. Morpholine is a six-membered heterocyclic compound containing one nitrogen atom, while the pyrimidine ring is a six-membered aromatic ring with two nitrogen atoms at positions 1 and 3. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of both nitrogen atoms, which can engage in hydrogen bonding. It may also display biological activity, making it of interest in medicinal chemistry and drug development. The presence of the pyrimidine ring can influence its interaction with biological targets, potentially leading to applications in pharmaceuticals. Additionally, the compound's stability and reactivity can be affected by the substituents on the rings, which may alter its chemical behavior and potential uses. Overall, 4-(5-Pyrimidinyl)morpholine is a versatile compound with implications in various fields, particularly in the development of therapeutic agents.
Formula:C8H11N3O
InChI:InChI=1S/C8H11N3O/c1-3-12-4-2-11(1)8-5-9-7-10-6-8/h5-7H,1-4H2
InChI key:InChIKey=OUVLEKPJCYSHSI-UHFFFAOYSA-N
SMILES:C=1(C=NC=NC1)N2CCOCC2
Synonyms:- 5-Morpholinopyrimidine
- Morpholine, 4-(5-pyrimidinyl)-
- 4-Morpholinopyrimidine
- 4-(5-Pyrimidinyl)morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
