CAS 912440-88-1
:(7R)-3-Bromo-2,5-dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-methanamine
Description:
(7R)-3-Bromo-2,5-dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-methanamine is a complex organic compound characterized by its bicyclic structure, which features a unique arrangement of carbon atoms forming a bicyclo[4.2.0] framework. The presence of bromine and methoxy groups contributes to its reactivity and potential applications in organic synthesis. The compound's stereochemistry is indicated by the (7R) designation, suggesting specific spatial arrangements of its atoms that can influence its biological activity and interactions. As an amine, it contains a nitrogen atom that can participate in hydrogen bonding, affecting its solubility and reactivity. The compound may exhibit interesting properties due to its conjugated diene system, which can lead to unique electronic characteristics. Its potential applications could span various fields, including medicinal chemistry and materials science, although specific biological or chemical activities would require further investigation. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential implications in research and development.
Formula:C11H14BrNO2
InChI:InChI=1S/C11H14BrNO2/c1-14-9-4-8(12)11(15-2)7-3-6(5-13)10(7)9/h4,6H,3,5,13H2,1-2H3/t6-/m0/s1
InChI key:InChIKey=MPBCKKVERDTCEL-LURJTMIESA-N
SMILES:O(C)C1=C2C([C@H](CN)C2)=C(OC)C=C1Br
Synonyms:- (7R)-3-Bromo-2,5-dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-methanamine
- [(7R)-3-Bromo-2,5-dimethoxybicyclo[4.2.0]octa-1(6),2,4-trien-7-yl]methanamine
- Bicyclo[4.2.0]octa-1,3,5-triene-7-methanamine, 3-bromo-2,5-dimethoxy-, (7R)-
- (3-bromo-2,5-dimethoxy-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)methanamine
- TIANFU-CHEM - (4-Bromo-3,6-dimethoxybenzocyclobuten-1-yl)methylaminehydrobromide
- (4-Bromo-3,6-dimethoxybenzocyclobuten-1-yl)methylaminehydrobromide
- TCB-2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(7R)-3-Bromo-2,5-dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-methanamine
CAS:Controlled ProductFormula:C11H14BrNO2Color and Shape:NeatMolecular weight:272.138
