CAS 91245-60-2
:1-(Phenylmethyl)cyclobutanamine
Description:
1-(Phenylmethyl)cyclobutanamine, identified by its CAS number 91245-60-2, is an organic compound characterized by a cyclobutane ring substituted with a phenylmethyl group and an amine functional group. This compound features a four-membered cyclobutane structure, which contributes to its unique ring strain and reactivity. The presence of the phenylmethyl group enhances its hydrophobic characteristics, while the amine group introduces basicity and potential for hydrogen bonding. As a secondary amine, it may participate in various chemical reactions, including alkylation and acylation. The compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, its physical properties, such as solubility and melting point, would be influenced by the balance between the hydrophobic phenyl group and the polar amine. Overall, 1-(Phenylmethyl)cyclobutanamine represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C11H15N
InChI:InChI=1S/C11H15N/c12-11(7-4-8-11)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9,12H2
InChI key:InChIKey=VDTOJIIWQIMYNV-UHFFFAOYSA-N
SMILES:C(C1(N)CCC1)C2=CC=CC=C2
Synonyms:- 1-(Phenylmethyl)cyclobutanamine
- 1-Benzylcyclobutan-1-amine
- 1-Benzylcyclobutanamine
- Cyclobutylamine, 1-benzyl-
- Cyclobutylamine,1-benzyl- (7CI)
- Cyclobutanamine, 1-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.