CAS 91245-89-5

N-methyl-1-[4-(prop-2-en-1-yloxy)phenyl]methanamine

Description:

N-methyl-1-[4-(prop-2-en-1-yloxy)phenyl]methanamine, identified by its CAS number 91245-89-5, is an organic compound characterized by its amine functional group and an allyl ether moiety. This substance features a methyl group attached to a methanamine backbone, which contributes to its basicity and potential reactivity in various chemical environments. The presence of the prop-2-en-1-yloxy group indicates that it can participate in reactions typical of alkenes, such as polymerization or addition reactions, making it of interest in synthetic organic chemistry. The phenyl ring provides aromatic stability and can influence the compound's solubility and interaction with other molecules. Overall, this compound's structure suggests potential applications in fields such as pharmaceuticals, materials science, or as an intermediate in organic synthesis, although specific applications would depend on further research into its properties and reactivity.

Formula: C₁₁H₁₅NO

InChI: InChI=1/C11H15NO/c1-3-8-13-11-6-4-10(5-7-11)9-12-2/h3-7,12H,1,8-9H2,2H3

SMILES: C=CCOc1ccc(cc1)CNC

Synonyms:

• N-[4-(allyloxy)benzyl]-N-methylamine

Methyl({[4-(prop-2-en-1-yloxy)phenyl]methyl})amine

CAS: 91245-89-5

Versatile small molecule scaffold

Formula: C₁₁H₁₅NO

Purity: Min. 95%

Molecular weight: 177.24 g/mol

Ref: 3D-RDA24589