CAS 912452-31-4
:4-[(1S)-(4-dimethylamino)-1-(4-fluotophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile 1/2(+)-Di-1,4-toluoyl-D-tartaric acid
Description:
The chemical substance known as "4-[(1S)-(4-dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile 1/2(+)-Di-1,4-toluoyl-D-tartaric acid" with CAS number 912452-31-4 is a complex organic compound that features multiple functional groups, including a benzonitrile moiety, a hydroxymethyl group, and a dimethylamino group. Its structure suggests potential applications in pharmaceuticals, particularly in the development of chiral drugs due to the presence of the tartaric acid derivative, which can facilitate enantioselective synthesis. The compound's chirality is indicated by the (1S) configuration, which may influence its biological activity and interaction with biological targets. Additionally, the presence of a fluorophenyl group may enhance lipophilicity and biological activity. The compound's solubility, stability, and reactivity would depend on its specific molecular interactions and the environment in which it is used. Overall, this substance exemplifies the complexity often found in drug design, where multiple functional groups are strategically incorporated to achieve desired pharmacological properties.
Formula:(C20H23FN2O2)C20H18O8
Synonyms:- Intermediates of (S)-Citalopram
- 4-[(1S)-(4-Dimethylamino)-1-(4-Fluotophenyl)-1-Hydroxybutyl]-3-(Hydroxymethyl)Benzonitrile (2R,3R)-2,3-Bis[(4-Methylbenzoyl)Oxy]Butanedioic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.