CAS 912468-80-5

1H-Imidazole-4-carbonyl chloride, 1-methyl-, hydrochloride (1:1)

Description:

1H-Imidazole-4-carbonyl chloride, 1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carbonyl chloride functional group, indicating the presence of a carbon atom double-bonded to an oxygen atom and single-bonded to a chlorine atom, which contributes to its reactivity. The hydrochloride form suggests that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable in certain conditions. Typically, compounds like this are used in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals, due to their ability to participate in various chemical reactions, such as acylation and nucleophilic substitution. The presence of the methyl group on the imidazole ring can influence the compound's biological activity and properties. As with many chemical substances, handling should be done with care, considering potential hazards associated with the carbonyl chloride moiety.

Formula: C₅H₅ClN₂O·ClH

InChI: InChI=1S/C5H5ClN2O.ClH/c1-8-2-4(5(6)9)7-3-8;/h2-3H,1H3;1H

InChI key: InChIKey=HVVHNDCZXDNLMC-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C1=CN(C)C=N1.Cl

Synonyms:

• 1H-Imidazole-4-carbonyl chloride, 1-methyl-, hydrochloride (1:1)
• 1H-Imidazole-4-carbonyl chloride, 1-methyl-, monohydrochloride
• 1-Methyl-1H-imidazole-4-carbonyl chloride hydrochloride

1-Methyl-1H-imidazole-4-carbonyl chloride hydrochloride

CAS: 912468-80-5

1-Methyl-1H-imidazole-4-carbonyl chloride hydrochloride

Purity: ≥95%

Molecular weight: 181.02g/mol

Ref: 54-OR40237