
CAS 91251-46-6
:β-Amino-α-methylbenzenepropanol
Description:
β-Amino-α-methylbenzenepropanol, also known by its CAS number 91251-46-6, is a chemical compound characterized by the presence of both an amino group and a hydroxyl group attached to a propanol backbone, along with a methyl-substituted phenyl group. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the hydroxyl group, while the aromatic ring may contribute to hydrophobic characteristics. The amino group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. β-Amino-α-methylbenzenepropanol may be of interest in pharmaceutical applications, particularly in the synthesis of various biologically active compounds. Its structural features suggest it could act as a chiral building block in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Safety and handling considerations should also be taken into account, as with any chemical substance.
Formula:C10H15NO
InChI:InChI=1S/C10H15NO/c1-8(12)10(11)7-9-5-3-2-4-6-9/h2-6,8,10,12H,7,11H2,1H3
InChI key:InChIKey=SMZUMFSKQVVOOV-UHFFFAOYSA-N
SMILES:C(C(C(C)O)N)C1=CC=CC=C1
Synonyms:- Benzenepropanol, β-amino-α-methyl-
- 3-Amino-4-phenylbutan-2-ol
- 2-Butanol, 3-amino-4-phenyl-
- β-Amino-α-methylbenzenepropanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.