
CAS 91251-57-9
:2-(2-Phenylethoxy)ethanamine
Description:
2-(2-Phenylethoxy)ethanamine, with the CAS number 91251-57-9, is an organic compound characterized by its amine functional group and ether linkage. It features a two-carbon ethylamine backbone substituted with a phenylethoxy group, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, reflecting its hydrophobic characteristics due to the phenyl group, while the amine group can engage in hydrogen bonding, influencing its reactivity and solubility in polar solvents. 2-(2-Phenylethoxy)ethanamine may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure allows for potential interactions with biological targets, which could lead to applications in drug development. However, detailed studies on its toxicity, stability, and specific applications are necessary to fully understand its behavior and potential uses in various fields.
Formula:C10H15NO
InChI:InChI=1S/C10H15NO/c11-7-9-12-8-6-10-4-2-1-3-5-10/h1-5H,6-9,11H2
InChI key:InChIKey=DEAFSYBOATUGFE-UHFFFAOYSA-N
SMILES:C(COCCN)C1=CC=CC=C1
Synonyms:- Ethanamine, 2-(2-phenylethoxy)-
- Ethylamine, 2-(phenethyloxy)-
- 2-(2-Phenylethoxy)ethan-1-amine
- 2-(2-Phenylethoxy)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.