CymitQuimica logo

CAS 912545-09-6

:

5-(1-Methylethenyl)-2,4-bis(phenylmethoxy)benzoic acid

Description:
5-(1-Methylethenyl)-2,4-bis(phenylmethoxy)benzoic acid, with the CAS number 912545-09-6, is an organic compound characterized by its complex structure, which includes a benzoic acid core substituted with multiple functional groups. The presence of the methylethenyl group contributes to its potential reactivity and hydrophobic characteristics, while the bis(phenylmethoxy) substituents enhance its solubility in organic solvents and may influence its interaction with biological systems. This compound may exhibit properties such as UV absorption, making it of interest in photochemical applications or as a potential additive in polymer formulations. Its molecular structure suggests potential applications in materials science, particularly in the development of light-absorbing materials or as a precursor in organic synthesis. Additionally, the presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions, potentially forming salts or esters under appropriate conditions. Overall, this compound's unique structural features may confer specific physical and chemical properties that are valuable in various industrial and research applications.
Formula:C24H22O4
InChI:InChI=1S/C24H22O4/c1-17(2)20-13-21(24(25)26)23(28-16-19-11-7-4-8-12-19)14-22(20)27-15-18-9-5-3-6-10-18/h3-14H,1,15-16H2,2H3,(H,25,26)
InChI key:InChIKey=GADYYKPUHQGBOT-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(C(C)=C)C=C(C(O)=O)C(OCC3=CC=CC=C3)=C2
Synonyms:
  • Benzoic acid, 5-(1-methylethenyl)-2,4-bis(phenylmethoxy)-
  • 2,4-Bis(benzyloxy)-5-isopropenylbenzoic acid
  • 2,4-Bis(benzyloxy)-5-(prop-1-en-2-yl)benzoic acid
  • 5-(1-Methylethenyl)-2,4-bis(phenylmethoxy)benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.