CAS 912569-58-5
:ethyl 2-(4-methyl-1,4-diazepan-1-yl)benzoate
Description:
Ethyl 2-(4-methyl-1,4-diazepan-1-yl)benzoate, identified by its CAS number 912569-58-5, is a chemical compound characterized by its unique structure, which includes an ethyl ester functional group and a diazepane moiety. This compound typically exhibits properties associated with both esters and nitrogen-containing heterocycles. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the diazepane ring suggests potential biological activity, as many diazepane derivatives are known for their pharmacological properties. Ethyl 2-(4-methyl-1,4-diazepan-1-yl)benzoate may be soluble in organic solvents and exhibit moderate stability under standard conditions. Its reactivity could include hydrolysis under acidic or basic conditions, typical of ester compounds. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of new therapeutic agents, due to the structural features that can influence biological interactions. However, specific safety and handling information should be consulted from material safety data sheets (MSDS) or relevant literature.
Formula:C15H22N2O2
InChI:InChI=1/C15H22N2O2/c1-3-19-15(18)13-7-4-5-8-14(13)17-10-6-9-16(2)11-12-17/h4-5,7-8H,3,6,9-12H2,1-2H3
SMILES:CCOC(=O)c1ccccc1N1CCCN(C)CC1
Synonyms:- Ethyl 2-(4-Methylperhydro-1,4-Diazepin-1-Yl)Benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.