CAS 912569-61-0
:3-[3-(chloromethyl)phenyl]-1-methyl-pyrazole
Description:
3-[3-(Chloromethyl)phenyl]-1-methyl-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a chloromethyl group attached to a phenyl ring enhances its reactivity and potential applications in various chemical reactions. The methyl group on the pyrazole contributes to its overall stability and influences its solubility in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests potential interactions with biological targets, which could lead to various pharmacological effects. Additionally, the presence of halogen atoms, such as chlorine, often enhances lipophilicity, affecting the compound's distribution and metabolism in biological systems. Overall, 3-[3-(chloromethyl)phenyl]-1-methyl-pyrazole is a versatile compound with potential applications in research and industry, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C11H11ClN2
InChI:InChI=1/C11H11ClN2/c1-14-6-5-11(13-14)10-4-2-3-9(7-10)8-12/h2-7H,8H2,1H3
SMILES:Cn1ccc(c2cccc(c2)CCl)n1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-[3-(Chloromethyl)phenyl]-1-methyl-1H-pyrazole
CAS:3-[3-(Chloromethyl)phenyl]-1-methyl-1H-pyrazolePurity:techColor and Shape:Brown LiquidMolecular weight:206.67g/mol
