CAS 912569-62-1
:3-(2-Methyl-1H-imidazol-1-yl)benzenemethanamine
Description:
3-(2-Methyl-1H-imidazol-1-yl)benzenemethanamine, with the CAS number 912569-62-1, is a chemical compound characterized by its unique structure, which includes a benzene ring substituted with a methanamine group and an imidazole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity and solubility in various organic solvents. The presence of the imidazole ring suggests that it may participate in hydrogen bonding and coordination with metal ions, which can be relevant in biological systems or catalysis. Additionally, the methyl group on the imidazole can influence the compound's steric and electronic properties, potentially affecting its reactivity and interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry and materials science due to its structural features and potential applications. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require experimental determination or detailed literature references for precise values.
Formula:C11H13N3
InChI:InChI=1S/C11H13N3/c1-9-13-5-6-14(9)11-4-2-3-10(7-11)8-12/h2-7H,8,12H2,1H3
InChI key:InChIKey=CECWODAAUDOPCU-UHFFFAOYSA-N
SMILES:CC=1N(C=CN1)C2=CC(CN)=CC=C2
Synonyms:- 3-(2-Methyl-1H-imidazol-1-yl)benzenemethanamine
- 3-(2-Methylimidazol-1-yl)benzylamine
- Benzenemethanamine, 3-(2-methyl-1H-imidazol-1-yl)-
- [3-(2-Methyl-1H-imidazol-1-yl)phenyl]methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(2-Methyl-1H-imidazol-1-yl)benzylamine
CAS:Controlled ProductFormula:C11H13N3Color and Shape:NeatMolecular weight:187.241
