CAS 912569-63-2

4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-carbonitrile

Description:

4-Methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-carbonitrile is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyridine and an oxazine ring. This compound features a methyl group at the 4-position and a cyano group at the 7-position, contributing to its chemical reactivity and potential biological activity. The presence of the carbonitrile functional group suggests that it may participate in nucleophilic reactions, while the oxazine ring can influence its solubility and stability. The compound's unique structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular interactions, such as hydrogen bonding and π-π stacking, can affect its behavior in biological systems. Additionally, the compound's synthesis and characterization would typically involve techniques such as NMR spectroscopy, mass spectrometry, and crystallography to confirm its structure and purity. Overall, 4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-carbonitrile represents a fascinating subject for research in organic and medicinal chemistry.

Formula: C₉H₉N₃O

InChI: InChI=1/C9H9N3O/c1-12-2-3-13-8-4-7(5-10)6-11-9(8)12/h4,6H,2-3H2,1H3

SMILES: CN1CCOc2cc(C#N)cnc12

Synonyms:

• 4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-carbonitrile
• 4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-carbonitrile 97%
• 4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-carbonitrile97%

4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-carbonitrile

CAS: 912569-63-2

4-Methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-7-carbonitrile

Purity: 97%

Molecular weight: 175.19g/mol

Ref: 54-OR6087