CAS 912569-67-6

N-methyl-1-[4-(6-methylpyrazin-2-yl)oxyphenyl]methanamine

Description:

N-methyl-1-[4-(6-methylpyrazin-2-yl)oxyphenyl]methanamine, with the CAS number 912569-67-6, is a chemical compound characterized by its complex structure, which includes a methanamine core substituted with a methyl group and a phenyl ring that is further substituted with a pyrazine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the pyrazine ring, which is a heterocyclic aromatic compound, may impart additional characteristics such as increased lipophilicity and potential biological activity. The methoxyphenyl group enhances the compound's stability and solubility in organic solvents. Due to its structural features, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as it could interact with biological targets through various mechanisms. However, specific physical and chemical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from detailed chemical databases.

Formula: C₁₃H₁₅N₃O

InChI: InChI=1/C13H15N3O/c1-10-7-15-9-13(16-10)17-12-5-3-11(4-6-12)8-14-2/h3-7,9,14H,8H2,1-2H3

SMILES: Cc1cncc(n1)Oc1ccc(cc1)CNC