CAS 912569-70-1
:4-Bromo-1-methyl-1H-pyrazole-3-carbonyl chloride
Description:
4-Bromo-1-methyl-1H-pyrazole-3-carbonyl chloride is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a bromine atom and a carbonyl chloride functional group. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its reactivity, particularly due to the presence of the carbonyl chloride group, which can participate in nucleophilic substitution reactions. The bromine substituent can also influence the compound's reactivity and stability, making it useful in various synthetic applications. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or other organic compounds, owing to its ability to serve as an intermediate in chemical reactions. Additionally, it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its potential applications in medicinal chemistry. As with many halogenated compounds, appropriate safety measures should be taken when handling this substance due to its potential toxicity and reactivity.
Formula:C5H4BrClN2O
InChI:InChI=1/C5H4BrClN2O/c1-9-2-3(6)4(8-9)5(7)10/h2H,1H3
InChI key:InChIKey=LTARGXLMISJCPP-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=NN(C)C=C1Br
Synonyms:- 1H-pyrazole-3-carbonyl chloride, 4-bromo-1-methyl-
- 4-Bromo-1-methyl-1H-pyrazole-3-carbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.